C21H17ClN2O5S — CID 22564866
(2-chlorophenyl) 3-[(4-methylphenyl)sulfonylcarbamoylamino]benzoate (PubChem CID 22564866) has the molecular formula C21H17ClN2O5S and a molecular weight of 444.90 g/mol. Its IUPAC name is (2-chlorophenyl) 3-[(4-methylphenyl)sulfonylcarbamoylamino]benzoate.
| Compound Name | (2-chlorophenyl) 3-[(4-methylphenyl)sulfonylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 22564866 |
| Molecular Formula | C21H17ClN2O5S |
| Molecular Weight | 444.90 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | (2-chlorophenyl) 3-[(4-methylphenyl)sulfonylcarbamoylamino]benzoate |
| SMILES | Cc1ccc(S(=O)(=O)NC(=O)Nc2cccc(C(=O)Oc3ccccc3Cl)c2)cc1 |
| InChI | InChI=1S/C21H17ClN2O5S/c1-14-9-11-17(12-10-14)30(27,28)24-21(26)23-16-6-4-5-15(13-16)20(25)29-19-8-3-2-7-18(19)22/h2-13H,1H3,(H2,23,24,26) |
| InChIKey | QXJTZCVONAKTIN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.90 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|