C15H12N2O7S — CID 67689282
3-[(4-carboxyphenyl)sulfonylcarbamoylamino]benzoic acid (PubChem CID 67689282) has the molecular formula C15H12N2O7S and a molecular weight of 364.34 g/mol. Its IUPAC name is 3-[(4-carboxyphenyl)sulfonylcarbamoylamino]benzoic acid.
| Compound Name | 3-[(4-carboxyphenyl)sulfonylcarbamoylamino]benzoic acid |
|---|---|
| PubChem CID | 67689282 |
| Molecular Formula | C15H12N2O7S |
| Molecular Weight | 364.34 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 3-[(4-carboxyphenyl)sulfonylcarbamoylamino]benzoic acid |
| SMILES | O=C(Nc1cccc(C(=O)O)c1)NS(=O)(=O)c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C15H12N2O7S/c18-13(19)9-4-6-12(7-5-9)25(23,24)17-15(22)16-11-3-1-2-10(8-11)14(20)21/h1-8H,(H,18,19)(H,20,21)(H2,16,17,22) |
| InChIKey | XGWQJFUMZRUDFV-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 149.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |