C16H17N3O4S — CID 2954248
1-(3-acetylphenyl)-3-[4-(methylsulfamoyl)phenyl]urea (PubChem CID 2954248) has the molecular formula C16H17N3O4S and a molecular weight of 347.40 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[4-(methylsulfamoyl)phenyl]urea.
| Compound Name | 1-(3-acetylphenyl)-3-[4-(methylsulfamoyl)phenyl]urea |
|---|---|
| PubChem CID | 2954248 |
| Molecular Formula | C16H17N3O4S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[4-(methylsulfamoyl)phenyl]urea |
| SMILES | CNS(=O)(=O)c1ccc(NC(=O)Nc2cccc(C(C)=O)c2)cc1 |
| InChI | InChI=1S/C16H17N3O4S/c1-11(20)12-4-3-5-14(10-12)19-16(21)18-13-6-8-15(9-7-13)24(22,23)17-2/h3-10,17H,1-2H3,(H2,18,19,21) |
| InChIKey | BEUUFECVWGDJFX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |