C21H19N3O3S2 — CID 25237665
1-(3-acetylphenyl)-3-[4-(phenylsulfamoyl)phenyl]thiourea (PubChem CID 25237665) has the molecular formula C21H19N3O3S2 and a molecular weight of 425.54 g/mol. Its IUPAC name is 1-(3-acetylphenyl)-3-[4-(phenylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-(3-acetylphenyl)-3-[4-(phenylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 25237665 |
| Molecular Formula | C21H19N3O3S2 |
| Molecular Weight | 425.54 g/mol |
| Exact Mass | 425.09 |
| IUPAC Name | 1-(3-acetylphenyl)-3-[4-(phenylsulfamoyl)phenyl]thiourea |
| SMILES | CC(=O)c1cccc(NC(=S)Nc2ccc(S(=O)(=O)Nc3ccccc3)cc2)c1 |
| InChI | InChI=1S/C21H19N3O3S2/c1-15(25)16-6-5-9-19(14-16)23-21(28)22-17-10-12-20(13-11-17)29(26,27)24-18-7-3-2-4-8-18/h2-14,24H,1H3,(H2,22,23,28) |
| InChIKey | BZTMUSKLJNKDCV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.54 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|