C20H16ClN3O3S2 — CID 4940381
3-chloro-N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 4940381) has the molecular formula C20H16ClN3O3S2 and a molecular weight of 445.95 g/mol. Its IUPAC name is 3-chloro-N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-chloro-N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4940381 |
| Molecular Formula | C20H16ClN3O3S2 |
| Molecular Weight | 445.95 g/mol |
| Exact Mass | 445.03 |
| IUPAC Name | 3-chloro-N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1ccc(S(=O)(=O)Nc2ccccc2)cc1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H16ClN3O3S2/c21-15-6-4-5-14(13-15)19(25)23-20(28)22-16-9-11-18(12-10-16)29(26,27)24-17-7-2-1-3-8-17/h1-13,24H,(H2,22,23,25,28) |
| InChIKey | MUUXRQRABZAQSG-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.95 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|