C23H23N3O3S2 — CID 17177606
N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]-4-propan-2-ylbenzamide (PubChem CID 17177606) has the molecular formula C23H23N3O3S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]-4-propan-2-ylbenzamide.
| Compound Name | N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 17177606 |
| Molecular Formula | C23H23N3O3S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-[[4-(phenylsulfamoyl)phenyl]carbamothioyl]-4-propan-2-ylbenzamide |
| SMILES | CC(C)c1ccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)Nc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C23H23N3O3S2/c1-16(2)17-8-10-18(11-9-17)22(27)25-23(30)24-19-12-14-21(15-13-19)31(28,29)26-20-6-4-3-5-7-20/h3-16,26H,1-2H3,(H2,24,25,27,30) |
| InChIKey | JRBBBDIDENIMHS-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|