C17H20ClN3OS — CID 88531052
N-[(4-aminophenyl)carbamothioyl]-4-propan-2-ylbenzamide;hydrochloride (PubChem CID 88531052) has the molecular formula C17H20ClN3OS and a molecular weight of 349.89 g/mol. Its IUPAC name is N-[(4-aminophenyl)carbamothioyl]-4-propan-2-ylbenzamide;hydrochloride.
| Compound Name | N-[(4-aminophenyl)carbamothioyl]-4-propan-2-ylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 88531052 |
| Molecular Formula | C17H20ClN3OS |
| Molecular Weight | 349.89 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[(4-aminophenyl)carbamothioyl]-4-propan-2-ylbenzamide;hydrochloride |
| SMILES | CC(C)c1ccc(C(=O)NC(=S)Nc2ccc(N)cc2)cc1.Cl |
| InChI | InChI=1S/C17H19N3OS.ClH/c1-11(2)12-3-5-13(6-4-12)16(21)20-17(22)19-15-9-7-14(18)8-10-15;/h3-11H,18H2,1-2H3,(H2,19,20,21,22);1H |
| InChIKey | SSIOCIKNBXTGGG-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.89 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|