C15H15BrClN3OS — CID 87563712
N-[(4-aminophenyl)carbamothioyl]-4-bromo-3-methylbenzamide;hydrochloride (PubChem CID 87563712) has the molecular formula C15H15BrClN3OS and a molecular weight of 400.73 g/mol. Its IUPAC name is N-[(4-aminophenyl)carbamothioyl]-4-bromo-3-methylbenzamide;hydrochloride.
| Compound Name | N-[(4-aminophenyl)carbamothioyl]-4-bromo-3-methylbenzamide;hydrochloride |
|---|---|
| PubChem CID | 87563712 |
| Molecular Formula | C15H15BrClN3OS |
| Molecular Weight | 400.73 g/mol |
| Exact Mass | 398.98 |
| IUPAC Name | N-[(4-aminophenyl)carbamothioyl]-4-bromo-3-methylbenzamide;hydrochloride |
| SMILES | Cc1cc(C(=O)NC(=S)Nc2ccc(N)cc2)ccc1Br.Cl |
| InChI | InChI=1S/C15H14BrN3OS.ClH/c1-9-8-10(2-7-13(9)16)14(20)19-15(21)18-12-5-3-11(17)4-6-12;/h2-8H,17H2,1H3,(H2,18,19,20,21);1H |
| InChIKey | LIBBMMHTCJTIQU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.73 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|