C23H19BrN2OS — CID 6232744
3-bromo-4-methyl-N-[[4-[(E)-2-phenylethenyl]phenyl]carbamothioyl]benzamide (PubChem CID 6232744) has the molecular formula C23H19BrN2OS and a molecular weight of 451.39 g/mol. Its IUPAC name is 3-bromo-4-methyl-N-[[4-[(E)-2-phenylethenyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-methyl-N-[[4-[(E)-2-phenylethenyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 6232744 |
| Molecular Formula | C23H19BrN2OS |
| Molecular Weight | 451.39 g/mol |
| Exact Mass | 450.04 |
| IUPAC Name | 3-bromo-4-methyl-N-[[4-[(E)-2-phenylethenyl]phenyl]carbamothioyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2ccc(/C=C/c3ccccc3)cc2)cc1Br |
| InChI | InChI=1S/C23H19BrN2OS/c1-16-7-12-19(15-21(16)24)22(27)26-23(28)25-20-13-10-18(11-14-20)9-8-17-5-3-2-4-6-17/h2-15H,1H3,(H2,25,26,27,28)/b9-8+ |
| InChIKey | PLHWYYMMSAVAGV-CMDGGOBGSA-N |
| XLogP | 6.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.39 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|