C16H14Br2N2OS — CID 54784442
3-bromo-N-[(2-bromo-4-methylphenyl)carbamothioyl]-4-methylbenzamide (PubChem CID 54784442) has the molecular formula C16H14Br2N2OS and a molecular weight of 442.18 g/mol. Its IUPAC name is 3-bromo-N-[(2-bromo-4-methylphenyl)carbamothioyl]-4-methylbenzamide.
| Compound Name | 3-bromo-N-[(2-bromo-4-methylphenyl)carbamothioyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 54784442 |
| Molecular Formula | C16H14Br2N2OS |
| Molecular Weight | 442.18 g/mol |
| Exact Mass | 439.92 |
| IUPAC Name | 3-bromo-N-[(2-bromo-4-methylphenyl)carbamothioyl]-4-methylbenzamide |
| SMILES | Cc1ccc(NC(=S)NC(=O)c2ccc(C)c(Br)c2)c(Br)c1 |
| InChI | InChI=1S/C16H14Br2N2OS/c1-9-3-6-14(13(18)7-9)19-16(22)20-15(21)11-5-4-10(2)12(17)8-11/h3-8H,1-2H3,(H2,19,20,21,22) |
| InChIKey | NYNBBDKFOXBIQI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.18 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|