C21H24Br2N2O2S — CID 54784702
3-bromo-N-[(2-bromo-4-methylphenyl)carbamothioyl]-4-hexoxybenzamide (PubChem CID 54784702) has the molecular formula C21H24Br2N2O2S and a molecular weight of 528.31 g/mol. Its IUPAC name is 3-bromo-N-[(2-bromo-4-methylphenyl)carbamothioyl]-4-hexoxybenzamide.
| Compound Name | 3-bromo-N-[(2-bromo-4-methylphenyl)carbamothioyl]-4-hexoxybenzamide |
|---|---|
| PubChem CID | 54784702 |
| Molecular Formula | C21H24Br2N2O2S |
| Molecular Weight | 528.31 g/mol |
| Exact Mass | 525.99 |
| IUPAC Name | 3-bromo-N-[(2-bromo-4-methylphenyl)carbamothioyl]-4-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(C(=O)NC(=S)Nc2ccc(C)cc2Br)cc1Br |
| InChI | InChI=1S/C21H24Br2N2O2S/c1-3-4-5-6-11-27-19-10-8-15(13-17(19)23)20(26)25-21(28)24-18-9-7-14(2)12-16(18)22/h7-10,12-13H,3-6,11H2,1-2H3,(H2,24,25,26,28) |
| InChIKey | GCVAIDQSJNGFHD-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.31 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|