C16H14BrIN2O2S — CID 54784411
N-[(2-bromo-4-methylphenyl)carbamothioyl]-3-iodo-4-methoxybenzamide (PubChem CID 54784411) has the molecular formula C16H14BrIN2O2S and a molecular weight of 505.18 g/mol. Its IUPAC name is N-[(2-bromo-4-methylphenyl)carbamothioyl]-3-iodo-4-methoxybenzamide.
| Compound Name | N-[(2-bromo-4-methylphenyl)carbamothioyl]-3-iodo-4-methoxybenzamide |
|---|---|
| PubChem CID | 54784411 |
| Molecular Formula | C16H14BrIN2O2S |
| Molecular Weight | 505.18 g/mol |
| Exact Mass | 503.90 |
| IUPAC Name | N-[(2-bromo-4-methylphenyl)carbamothioyl]-3-iodo-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2ccc(C)cc2Br)cc1I |
| InChI | InChI=1S/C16H14BrIN2O2S/c1-9-3-5-13(11(17)7-9)19-16(23)20-15(21)10-4-6-14(22-2)12(18)8-10/h3-8H,1-2H3,(H2,19,20,21,23) |
| InChIKey | VDZAJQJNHJELKJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.18 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|