C15H11BrCl2N2OS — CID 54784823
N-[(2-bromo-4-methylphenyl)carbamothioyl]-3,5-dichlorobenzamide (PubChem CID 54784823) has the molecular formula C15H11BrCl2N2OS and a molecular weight of 418.14 g/mol. Its IUPAC name is N-[(2-bromo-4-methylphenyl)carbamothioyl]-3,5-dichlorobenzamide.
| Compound Name | N-[(2-bromo-4-methylphenyl)carbamothioyl]-3,5-dichlorobenzamide |
|---|---|
| PubChem CID | 54784823 |
| Molecular Formula | C15H11BrCl2N2OS |
| Molecular Weight | 418.14 g/mol |
| Exact Mass | 415.92 |
| IUPAC Name | N-[(2-bromo-4-methylphenyl)carbamothioyl]-3,5-dichlorobenzamide |
| SMILES | Cc1ccc(NC(=S)NC(=O)c2cc(Cl)cc(Cl)c2)c(Br)c1 |
| InChI | InChI=1S/C15H11BrCl2N2OS/c1-8-2-3-13(12(16)4-8)19-15(22)20-14(21)9-5-10(17)7-11(18)6-9/h2-7H,1H3,(H2,19,20,21,22) |
| InChIKey | YUAGIMCBYZHZJS-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.14 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|