C18H19BrN2O2S — CID 1188241
N-[(2-bromo-4-methylphenyl)carbamothioyl]-2-(2,5-dimethylphenoxy)acetamide (PubChem CID 1188241) has the molecular formula C18H19BrN2O2S and a molecular weight of 407.33 g/mol. Its IUPAC name is N-[(2-bromo-4-methylphenyl)carbamothioyl]-2-(2,5-dimethylphenoxy)acetamide.
| Compound Name | N-[(2-bromo-4-methylphenyl)carbamothioyl]-2-(2,5-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 1188241 |
| Molecular Formula | C18H19BrN2O2S |
| Molecular Weight | 407.33 g/mol |
| Exact Mass | 406.04 |
| IUPAC Name | N-[(2-bromo-4-methylphenyl)carbamothioyl]-2-(2,5-dimethylphenoxy)acetamide |
| SMILES | Cc1ccc(NC(=S)NC(=O)COc2cc(C)ccc2C)c(Br)c1 |
| InChI | InChI=1S/C18H19BrN2O2S/c1-11-5-7-15(14(19)8-11)20-18(24)21-17(22)10-23-16-9-12(2)4-6-13(16)3/h4-9H,10H2,1-3H3,(H2,20,21,22,24) |
| InChIKey | GFMHYJMUCDDXOE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.33 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|