C19H20BrN3O4S — CID 3477652
N-[[(3-bromo-4-methoxybenzoyl)amino]carbamothioyl]-2-(2,5-dimethylphenoxy)acetamide (PubChem CID 3477652) has the molecular formula C19H20BrN3O4S and a molecular weight of 466.36 g/mol. Its IUPAC name is N-[[(3-bromo-4-methoxybenzoyl)amino]carbamothioyl]-2-(2,5-dimethylphenoxy)acetamide.
| Compound Name | N-[[(3-bromo-4-methoxybenzoyl)amino]carbamothioyl]-2-(2,5-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 3477652 |
| Molecular Formula | C19H20BrN3O4S |
| Molecular Weight | 466.36 g/mol |
| Exact Mass | 465.04 |
| IUPAC Name | N-[[(3-bromo-4-methoxybenzoyl)amino]carbamothioyl]-2-(2,5-dimethylphenoxy)acetamide |
| SMILES | COc1ccc(C(=O)NNC(=S)NC(=O)COc2cc(C)ccc2C)cc1Br |
| InChI | InChI=1S/C19H20BrN3O4S/c1-11-4-5-12(2)16(8-11)27-10-17(24)21-19(28)23-22-18(25)13-6-7-15(26-3)14(20)9-13/h4-9H,10H2,1-3H3,(H,22,25)(H2,21,23,24,28) |
| InChIKey | IMSZZAVXEQUSGC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|