C19H20N2O3S — CID 28686958
2-[4-[(4-propan-2-ylbenzoyl)carbamothioylamino]phenyl]acetic acid (PubChem CID 28686958) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 2-[4-[(4-propan-2-ylbenzoyl)carbamothioylamino]phenyl]acetic acid.
| Compound Name | 2-[4-[(4-propan-2-ylbenzoyl)carbamothioylamino]phenyl]acetic acid |
|---|---|
| PubChem CID | 28686958 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 2-[4-[(4-propan-2-ylbenzoyl)carbamothioylamino]phenyl]acetic acid |
| SMILES | CC(C)c1ccc(C(=O)NC(=S)Nc2ccc(CC(=O)O)cc2)cc1 |
| InChI | InChI=1S/C19H20N2O3S/c1-12(2)14-5-7-15(8-6-14)18(24)21-19(25)20-16-9-3-13(4-10-16)11-17(22)23/h3-10,12H,11H2,1-2H3,(H,22,23)(H2,20,21,24,25) |
| InChIKey | BZJDVPINCHOPRB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|