C20H24N2OS — CID 17099848
N-[(4-butan-2-ylphenyl)carbamothioyl]-4-ethylbenzamide (PubChem CID 17099848) has the molecular formula C20H24N2OS and a molecular weight of 340.49 g/mol. Its IUPAC name is N-[(4-butan-2-ylphenyl)carbamothioyl]-4-ethylbenzamide.
| Compound Name | N-[(4-butan-2-ylphenyl)carbamothioyl]-4-ethylbenzamide |
|---|---|
| PubChem CID | 17099848 |
| Molecular Formula | C20H24N2OS |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | N-[(4-butan-2-ylphenyl)carbamothioyl]-4-ethylbenzamide |
| SMILES | CCc1ccc(C(=O)NC(=S)Nc2ccc(C(C)CC)cc2)cc1 |
| InChI | InChI=1S/C20H24N2OS/c1-4-14(3)16-10-12-18(13-11-16)21-20(24)22-19(23)17-8-6-15(5-2)7-9-17/h6-14H,4-5H2,1-3H3,(H2,21,22,23,24) |
| InChIKey | YZGPWQNXCSWWSN-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|