C22H21N3OS — CID 1317508
4-ethyl-N-[[4-(pyridin-4-ylmethyl)phenyl]carbamothioyl]benzamide (PubChem CID 1317508) has the molecular formula C22H21N3OS and a molecular weight of 375.50 g/mol. Its IUPAC name is 4-ethyl-N-[[4-(pyridin-4-ylmethyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 4-ethyl-N-[[4-(pyridin-4-ylmethyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1317508 |
| Molecular Formula | C22H21N3OS |
| Molecular Weight | 375.50 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 4-ethyl-N-[[4-(pyridin-4-ylmethyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCc1ccc(C(=O)NC(=S)Nc2ccc(Cc3ccncc3)cc2)cc1 |
| InChI | InChI=1S/C22H21N3OS/c1-2-16-3-7-19(8-4-16)21(26)25-22(27)24-20-9-5-17(6-10-20)15-18-11-13-23-14-12-18/h3-14H,2,15H2,1H3,(H2,24,25,26,27) |
| InChIKey | CEACYRRSKPVFOZ-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.50 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|