C21H18ClN3O2S — CID 1143892
5-chloro-2-methoxy-N-[[4-(pyridin-4-ylmethyl)phenyl]carbamothioyl]benzamide (PubChem CID 1143892) has the molecular formula C21H18ClN3O2S and a molecular weight of 411.91 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[[4-(pyridin-4-ylmethyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[[4-(pyridin-4-ylmethyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1143892 |
| Molecular Formula | C21H18ClN3O2S |
| Molecular Weight | 411.91 g/mol |
| Exact Mass | 411.08 |
| IUPAC Name | 5-chloro-2-methoxy-N-[[4-(pyridin-4-ylmethyl)phenyl]carbamothioyl]benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)NC(=S)Nc1ccc(Cc2ccncc2)cc1 |
| InChI | InChI=1S/C21H18ClN3O2S/c1-27-19-7-4-16(22)13-18(19)20(26)25-21(28)24-17-5-2-14(3-6-17)12-15-8-10-23-11-9-15/h2-11,13H,12H2,1H3,(H2,24,25,26,28) |
| InChIKey | ZBABYDOOUKYZEW-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.91 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|