C21H17Cl2N3O2S — CID 1395484
3,5-dichloro-4-methoxy-N-[[4-(pyridin-4-ylmethyl)phenyl]carbamothioyl]benzamide (PubChem CID 1395484) has the molecular formula C21H17Cl2N3O2S and a molecular weight of 446.36 g/mol. Its IUPAC name is 3,5-dichloro-4-methoxy-N-[[4-(pyridin-4-ylmethyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3,5-dichloro-4-methoxy-N-[[4-(pyridin-4-ylmethyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 1395484 |
| Molecular Formula | C21H17Cl2N3O2S |
| Molecular Weight | 446.36 g/mol |
| Exact Mass | 445.04 |
| IUPAC Name | 3,5-dichloro-4-methoxy-N-[[4-(pyridin-4-ylmethyl)phenyl]carbamothioyl]benzamide |
| SMILES | COc1c(Cl)cc(C(=O)NC(=S)Nc2ccc(Cc3ccncc3)cc2)cc1Cl |
| InChI | InChI=1S/C21H17Cl2N3O2S/c1-28-19-17(22)11-15(12-18(19)23)20(27)26-21(29)25-16-4-2-13(3-5-16)10-14-6-8-24-9-7-14/h2-9,11-12H,10H2,1H3,(H2,25,26,27,29) |
| InChIKey | NAUVIJDLJMCUPI-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.36 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|