C21H19Cl2N5O4S2 — CID 89096264
3,5-dichloro-N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]-4-methoxybenzamide (PubChem CID 89096264) has the molecular formula C21H19Cl2N5O4S2 and a molecular weight of 540.45 g/mol. Its IUPAC name is 3,5-dichloro-N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]-4-methoxybenzamide.
| Compound Name | 3,5-dichloro-N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 89096264 |
| Molecular Formula | C21H19Cl2N5O4S2 |
| Molecular Weight | 540.45 g/mol |
| Exact Mass | 539.03 |
| IUPAC Name | 3,5-dichloro-N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]-4-methoxybenzamide |
| SMILES | COc1c(Cl)cc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)Nc3nc(C)cc(C)n3)cc2)cc1Cl |
| InChI | InChI=1S/C21H19Cl2N5O4S2/c1-11-8-12(2)25-20(24-11)28-34(30,31)15-6-4-14(5-7-15)26-21(33)27-19(29)13-9-16(22)18(32-3)17(23)10-13/h4-10H,1-3H3,(H,24,25,28)(H2,26,27,29,33) |
| InChIKey | NRBJTIJVECDVKU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|