C23H24BN5O5S2 — CID 89096301
CID 89096301 (PubChem CID 89096301) has the molecular formula C23H24BN5O5S2 and a molecular weight of 525.42 g/mol.
| Compound Name | CID 89096301 |
|---|---|
| PubChem CID | 89096301 |
| Molecular Formula | C23H24BN5O5S2 |
| Molecular Weight | 525.42 g/mol |
| Exact Mass | 525.13 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)Nc3nc(C)cc(C)n3)cc2)ccc1OCCOC |
| InChI | InChI=1S/C23H24BN5O5S2/c1-14-12-15(2)26-22(25-14)29-36(31,32)18-7-5-17(6-8-18)27-23(35)28-21(30)16-4-9-20(19(24)13-16)34-11-10-33-3/h4-9,12-13H,10-11H2,1-3H3,(H,25,26,29)(H2,27,28,30,35) |
| InChIKey | OQXVKFIEABZFCT-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 131.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.42 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|