C24H27N5O4S2 — CID 17140558
N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]-3-(2-methylpropoxy)benzamide (PubChem CID 17140558) has the molecular formula C24H27N5O4S2 and a molecular weight of 513.65 g/mol. Its IUPAC name is N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]-3-(2-methylpropoxy)benzamide.
| Compound Name | N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]-3-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 17140558 |
| Molecular Formula | C24H27N5O4S2 |
| Molecular Weight | 513.65 g/mol |
| Exact Mass | 513.15 |
| IUPAC Name | N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]-3-(2-methylpropoxy)benzamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3cccc(OCC(C)C)c3)cc2)n1 |
| InChI | InChI=1S/C24H27N5O4S2/c1-15(2)14-33-20-7-5-6-18(13-20)22(30)28-24(34)27-19-8-10-21(11-9-19)35(31,32)29-23-25-16(3)12-17(4)26-23/h5-13,15H,14H2,1-4H3,(H,25,26,29)(H2,27,28,30,34) |
| InChIKey | TZGQLVRCNUZEDS-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 122.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.65 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|