C27H26N4O5S — CID 4954948
N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-3-(2-phenoxyethoxy)benzamide (PubChem CID 4954948) has the molecular formula C27H26N4O5S and a molecular weight of 518.60 g/mol. Its IUPAC name is N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-3-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-3-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4954948 |
| Molecular Formula | C27H26N4O5S |
| Molecular Weight | 518.60 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-3-(2-phenoxyethoxy)benzamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(NC(=O)c3cccc(OCCOc4ccccc4)c3)cc2)n1 |
| InChI | InChI=1S/C27H26N4O5S/c1-19-17-20(2)29-27(28-19)31-37(33,34)25-13-11-22(12-14-25)30-26(32)21-7-6-10-24(18-21)36-16-15-35-23-8-4-3-5-9-23/h3-14,17-18H,15-16H2,1-2H3,(H,30,32)(H,28,29,31) |
| InChIKey | SUJWOIGUQTWNQI-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 119.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.60 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|