C21H20N2O5S — CID 4954916
3-(2-phenoxyethoxy)-N-(4-sulfamoylphenyl)benzamide (PubChem CID 4954916) has the molecular formula C21H20N2O5S and a molecular weight of 412.47 g/mol. Its IUPAC name is 3-(2-phenoxyethoxy)-N-(4-sulfamoylphenyl)benzamide.
| Compound Name | 3-(2-phenoxyethoxy)-N-(4-sulfamoylphenyl)benzamide |
|---|---|
| PubChem CID | 4954916 |
| Molecular Formula | C21H20N2O5S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.11 |
| IUPAC Name | 3-(2-phenoxyethoxy)-N-(4-sulfamoylphenyl)benzamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)c2cccc(OCCOc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C21H20N2O5S/c22-29(25,26)20-11-9-17(10-12-20)23-21(24)16-5-4-8-19(15-16)28-14-13-27-18-6-2-1-3-7-18/h1-12,15H,13-14H2,(H,23,24)(H2,22,25,26) |
| InChIKey | CFTJWTBQOXDMTC-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|