C55H44N2O6 — CID 4955553
3-(2-phenoxyethoxy)-N-[4-[9-[4-[[3-(2-phenoxyethoxy)benzoyl]amino]phenyl]fluoren-9-yl]phenyl]benzamide (PubChem CID 4955553) has the molecular formula C55H44N2O6 and a molecular weight of 828.96 g/mol. Its IUPAC name is 3-(2-phenoxyethoxy)-N-[4-[9-[4-[[3-(2-phenoxyethoxy)benzoyl]amino]phenyl]fluoren-9-yl]phenyl]benzamide.
| Compound Name | 3-(2-phenoxyethoxy)-N-[4-[9-[4-[[3-(2-phenoxyethoxy)benzoyl]amino]phenyl]fluoren-9-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 4955553 |
| Molecular Formula | C55H44N2O6 |
| Molecular Weight | 828.96 g/mol |
| Exact Mass | 828.32 |
| IUPAC Name | 3-(2-phenoxyethoxy)-N-[4-[9-[4-[[3-(2-phenoxyethoxy)benzoyl]amino]phenyl]fluoren-9-yl]phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C2(c3ccc(NC(=O)c4cccc(OCCOc5ccccc5)c4)cc3)c3ccccc3-c3ccccc32)cc1)c1cccc(OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C55H44N2O6/c58-53(39-13-11-19-47(37-39)62-35-33-60-45-15-3-1-4-16-45)56-43-29-25-41(26-30-43)55(51-23-9-7-21-49(51)50-22-8-10-24-52(50)55)42-27-31-44(32-28-42)57-54(59)40-14-12-20-48(38-40)63-36-34-61-46-17-5-2-6-18-46/h1-32,37-38H,33-36H2,(H,56,58)(H,57,59) |
| InChIKey | AFDONPFAXNTYRX-UHFFFAOYSA-N |
| XLogP | 11.47 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.96 |
| LogP ≤ 5 | 11.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|