C28H32N2O5S — CID 4955000
N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-3-(2-phenoxyethoxy)benzamide (PubChem CID 4955000) has the molecular formula C28H32N2O5S and a molecular weight of 508.64 g/mol. Its IUPAC name is N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-3-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-3-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4955000 |
| Molecular Formula | C28H32N2O5S |
| Molecular Weight | 508.64 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | N-[4-[cyclohexyl(methyl)sulfamoyl]phenyl]-3-(2-phenoxyethoxy)benzamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(NC(=O)c2cccc(OCCOc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C28H32N2O5S/c1-30(24-10-4-2-5-11-24)36(32,33)27-17-15-23(16-18-27)29-28(31)22-9-8-14-26(21-22)35-20-19-34-25-12-6-3-7-13-25/h3,6-9,12-18,21,24H,2,4-5,10-11,19-20H2,1H3,(H,29,31) |
| InChIKey | JVFUJKBCASYCSR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.64 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|