C29H33N3O4S2 — CID 17134683
N-[[4-[cyclohexyl(methyl)sulfamoyl]phenyl]carbamothioyl]-3-(2-phenylethoxy)benzamide (PubChem CID 17134683) has the molecular formula C29H33N3O4S2 and a molecular weight of 551.73 g/mol. Its IUPAC name is N-[[4-[cyclohexyl(methyl)sulfamoyl]phenyl]carbamothioyl]-3-(2-phenylethoxy)benzamide.
| Compound Name | N-[[4-[cyclohexyl(methyl)sulfamoyl]phenyl]carbamothioyl]-3-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17134683 |
| Molecular Formula | C29H33N3O4S2 |
| Molecular Weight | 551.73 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | N-[[4-[cyclohexyl(methyl)sulfamoyl]phenyl]carbamothioyl]-3-(2-phenylethoxy)benzamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(NC(=S)NC(=O)c2cccc(OCCc3ccccc3)c2)cc1 |
| InChI | InChI=1S/C29H33N3O4S2/c1-32(25-12-6-3-7-13-25)38(34,35)27-17-15-24(16-18-27)30-29(37)31-28(33)23-11-8-14-26(21-23)36-20-19-22-9-4-2-5-10-22/h2,4-5,8-11,14-18,21,25H,3,6-7,12-13,19-20H2,1H3,(H2,30,31,33,37) |
| InChIKey | ZGGDQAMQUTWAFF-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.73 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|