C29H33N3O5S2 — CID 4954653
N-[[4-[cyclohexyl(methyl)sulfamoyl]phenyl]carbamothioyl]-2-(2-phenoxyethoxy)benzamide (PubChem CID 4954653) has the molecular formula C29H33N3O5S2 and a molecular weight of 567.73 g/mol. Its IUPAC name is N-[[4-[cyclohexyl(methyl)sulfamoyl]phenyl]carbamothioyl]-2-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[[4-[cyclohexyl(methyl)sulfamoyl]phenyl]carbamothioyl]-2-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4954653 |
| Molecular Formula | C29H33N3O5S2 |
| Molecular Weight | 567.73 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | N-[[4-[cyclohexyl(methyl)sulfamoyl]phenyl]carbamothioyl]-2-(2-phenoxyethoxy)benzamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccccc2OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C29H33N3O5S2/c1-32(23-10-4-2-5-11-23)39(34,35)25-18-16-22(17-19-25)30-29(38)31-28(33)26-14-8-9-15-27(26)37-21-20-36-24-12-6-3-7-13-24/h3,6-9,12-19,23H,2,4-5,10-11,20-21H2,1H3,(H2,30,31,33,38) |
| InChIKey | BKGAZGHACJYTKC-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.73 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|