C23H31N3O5S2 — CID 17355986
N-[[4-(dipropylsulfamoyl)phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide (PubChem CID 17355986) has the molecular formula C23H31N3O5S2 and a molecular weight of 493.65 g/mol. Its IUPAC name is N-[[4-(dipropylsulfamoyl)phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide.
| Compound Name | N-[[4-(dipropylsulfamoyl)phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17355986 |
| Molecular Formula | C23H31N3O5S2 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | N-[[4-(dipropylsulfamoyl)phenyl]carbamothioyl]-2-(2-methoxyethoxy)benzamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccccc2OCCOC)cc1 |
| InChI | InChI=1S/C23H31N3O5S2/c1-4-14-26(15-5-2)33(28,29)19-12-10-18(11-13-19)24-23(32)25-22(27)20-8-6-7-9-21(20)31-17-16-30-3/h6-13H,4-5,14-17H2,1-3H3,(H2,24,25,27,32) |
| InChIKey | PFSHAPBSOSMGFK-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|