C30H29N3O5S2 — CID 4954540
N-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamothioyl]-2-(2-phenoxyethoxy)benzamide (PubChem CID 4954540) has the molecular formula C30H29N3O5S2 and a molecular weight of 575.71 g/mol. Its IUPAC name is N-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamothioyl]-2-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamothioyl]-2-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4954540 |
| Molecular Formula | C30H29N3O5S2 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.15 |
| IUPAC Name | N-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamothioyl]-2-(2-phenoxyethoxy)benzamide |
| SMILES | CCN(c1ccccc1)S(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccccc2OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C30H29N3O5S2/c1-2-33(24-11-5-3-6-12-24)40(35,36)26-19-17-23(18-20-26)31-30(39)32-29(34)27-15-9-10-16-28(27)38-22-21-37-25-13-7-4-8-14-25/h3-20H,2,21-22H2,1H3,(H2,31,32,34,39) |
| InChIKey | VFNDSBHEUBAXOI-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|