C26H29N3O5S2 — CID 17139814
3-(2-ethoxyethoxy)-N-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 17139814) has the molecular formula C26H29N3O5S2 and a molecular weight of 527.67 g/mol. Its IUPAC name is 3-(2-ethoxyethoxy)-N-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3-(2-ethoxyethoxy)-N-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17139814 |
| Molecular Formula | C26H29N3O5S2 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.15 |
| IUPAC Name | 3-(2-ethoxyethoxy)-N-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | CCOCCOc1cccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)N(CC)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C26H29N3O5S2/c1-3-29(22-10-6-5-7-11-22)36(31,32)24-15-13-21(14-16-24)27-26(35)28-25(30)20-9-8-12-23(19-20)34-18-17-33-4-2/h5-16,19H,3-4,17-18H2,1-2H3,(H2,27,28,30,35) |
| InChIKey | CCCSIIDQAQIXDE-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|