C26H29N3O4S2 — CID 17149974
3-butan-2-yloxy-N-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 17149974) has the molecular formula C26H29N3O4S2 and a molecular weight of 511.67 g/mol. Its IUPAC name is 3-butan-2-yloxy-N-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3-butan-2-yloxy-N-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17149974 |
| Molecular Formula | C26H29N3O4S2 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.16 |
| IUPAC Name | 3-butan-2-yloxy-N-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | CCC(C)Oc1cccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)N(CC)c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C26H29N3O4S2/c1-4-19(3)33-23-13-9-10-20(18-23)25(30)28-26(34)27-21-14-16-24(17-15-21)35(31,32)29(5-2)22-11-7-6-8-12-22/h6-19H,4-5H2,1-3H3,(H2,27,28,30,34) |
| InChIKey | NWDVIHJNCZBRIE-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|