C22H29N3O5S2 — CID 17160386
N-[[4-(butan-2-ylsulfamoyl)phenyl]carbamothioyl]-3-(2-ethoxyethoxy)benzamide (PubChem CID 17160386) has the molecular formula C22H29N3O5S2 and a molecular weight of 479.62 g/mol. Its IUPAC name is N-[[4-(butan-2-ylsulfamoyl)phenyl]carbamothioyl]-3-(2-ethoxyethoxy)benzamide.
| Compound Name | N-[[4-(butan-2-ylsulfamoyl)phenyl]carbamothioyl]-3-(2-ethoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17160386 |
| Molecular Formula | C22H29N3O5S2 |
| Molecular Weight | 479.62 g/mol |
| Exact Mass | 479.15 |
| IUPAC Name | N-[[4-(butan-2-ylsulfamoyl)phenyl]carbamothioyl]-3-(2-ethoxyethoxy)benzamide |
| SMILES | CCOCCOc1cccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)NC(C)CC)cc2)c1 |
| InChI | InChI=1S/C22H29N3O5S2/c1-4-16(3)25-32(27,28)20-11-9-18(10-12-20)23-22(31)24-21(26)17-7-6-8-19(15-17)30-14-13-29-5-2/h6-12,15-16,25H,4-5,13-14H2,1-3H3,(H2,23,24,26,31) |
| InChIKey | RTWJQHPNOHRNFL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.62 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|