C24H23N3O6S2 — CID 4954628
N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]-2-(2-phenoxyethoxy)benzamide (PubChem CID 4954628) has the molecular formula C24H23N3O6S2 and a molecular weight of 513.60 g/mol. Its IUPAC name is N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]-2-(2-phenoxyethoxy)benzamide.
| Compound Name | N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]-2-(2-phenoxyethoxy)benzamide |
|---|---|
| PubChem CID | 4954628 |
| Molecular Formula | C24H23N3O6S2 |
| Molecular Weight | 513.60 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | N-[[4-(acetylsulfamoyl)phenyl]carbamothioyl]-2-(2-phenoxyethoxy)benzamide |
| SMILES | CC(=O)NS(=O)(=O)c1ccc(NC(=S)NC(=O)c2ccccc2OCCOc2ccccc2)cc1 |
| InChI | InChI=1S/C24H23N3O6S2/c1-17(28)27-35(30,31)20-13-11-18(12-14-20)25-24(34)26-23(29)21-9-5-6-10-22(21)33-16-15-32-19-7-3-2-4-8-19/h2-14H,15-16H2,1H3,(H,27,28)(H2,25,26,29,34) |
| InChIKey | XUXLRTVFXXDXGB-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.60 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|