C24H24BrN3O4S2 — CID 17353131
5-bromo-2-ethoxy-N-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 17353131) has the molecular formula C24H24BrN3O4S2 and a molecular weight of 562.51 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-ethoxy-N-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17353131 |
| Molecular Formula | C24H24BrN3O4S2 |
| Molecular Weight | 562.51 g/mol |
| Exact Mass | 561.04 |
| IUPAC Name | 5-bromo-2-ethoxy-N-[[4-[ethyl(phenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | CCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(S(=O)(=O)N(CC)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H24BrN3O4S2/c1-3-28(19-8-6-5-7-9-19)34(30,31)20-13-11-18(12-14-20)26-24(33)27-23(29)21-16-17(25)10-15-22(21)32-4-2/h5-16H,3-4H2,1-2H3,(H2,26,27,29,33) |
| InChIKey | QADQZGZCTYHPQI-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|