C20H24BrN3O4S2 — CID 17160368
5-bromo-N-[[4-(butan-2-ylsulfamoyl)phenyl]carbamothioyl]-2-ethoxybenzamide (PubChem CID 17160368) has the molecular formula C20H24BrN3O4S2 and a molecular weight of 514.47 g/mol. Its IUPAC name is 5-bromo-N-[[4-(butan-2-ylsulfamoyl)phenyl]carbamothioyl]-2-ethoxybenzamide.
| Compound Name | 5-bromo-N-[[4-(butan-2-ylsulfamoyl)phenyl]carbamothioyl]-2-ethoxybenzamide |
|---|---|
| PubChem CID | 17160368 |
| Molecular Formula | C20H24BrN3O4S2 |
| Molecular Weight | 514.47 g/mol |
| Exact Mass | 513.04 |
| IUPAC Name | 5-bromo-N-[[4-(butan-2-ylsulfamoyl)phenyl]carbamothioyl]-2-ethoxybenzamide |
| SMILES | CCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(S(=O)(=O)NC(C)CC)cc1 |
| InChI | InChI=1S/C20H24BrN3O4S2/c1-4-13(3)24-30(26,27)16-9-7-15(8-10-16)22-20(29)23-19(25)17-12-14(21)6-11-18(17)28-5-2/h6-13,24H,4-5H2,1-3H3,(H2,22,23,25,29) |
| InChIKey | BJSSJNOQXANIMR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.47 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|