C21H20BrN3O5S2 — CID 17171112
5-bromo-2-ethoxy-N-[[4-(furan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 17171112) has the molecular formula C21H20BrN3O5S2 and a molecular weight of 538.45 g/mol. Its IUPAC name is 5-bromo-2-ethoxy-N-[[4-(furan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-ethoxy-N-[[4-(furan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17171112 |
| Molecular Formula | C21H20BrN3O5S2 |
| Molecular Weight | 538.45 g/mol |
| Exact Mass | 537.00 |
| IUPAC Name | 5-bromo-2-ethoxy-N-[[4-(furan-2-ylmethylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C21H20BrN3O5S2/c1-2-29-19-10-5-14(22)12-18(19)20(26)25-21(31)24-15-6-8-17(9-7-15)32(27,28)23-13-16-4-3-11-30-16/h3-12,23H,2,13H2,1H3,(H2,24,25,26,31) |
| InChIKey | UXORDPAZKROMRF-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 109.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.45 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|