C22H23N3O6S — CID 2534066
2-ethoxy-N-[2-[4-(furan-2-ylmethylsulfamoyl)anilino]-2-oxoethyl]benzamide (PubChem CID 2534066) has the molecular formula C22H23N3O6S and a molecular weight of 457.51 g/mol. Its IUPAC name is 2-ethoxy-N-[2-[4-(furan-2-ylmethylsulfamoyl)anilino]-2-oxoethyl]benzamide.
| Compound Name | 2-ethoxy-N-[2-[4-(furan-2-ylmethylsulfamoyl)anilino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 2534066 |
| Molecular Formula | C22H23N3O6S |
| Molecular Weight | 457.51 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 2-ethoxy-N-[2-[4-(furan-2-ylmethylsulfamoyl)anilino]-2-oxoethyl]benzamide |
| SMILES | CCOc1ccccc1C(=O)NCC(=O)Nc1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C22H23N3O6S/c1-2-30-20-8-4-3-7-19(20)22(27)23-15-21(26)25-16-9-11-18(12-10-16)32(28,29)24-14-17-6-5-13-31-17/h3-13,24H,2,14-15H2,1H3,(H,23,27)(H,25,26) |
| InChIKey | RLWCPAFERUEACI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.51 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |