C20H18FN3O5S — CID 2471000
2-fluoro-N-[2-[4-(furan-2-ylmethylsulfamoyl)anilino]-2-oxoethyl]benzamide (PubChem CID 2471000) has the molecular formula C20H18FN3O5S and a molecular weight of 431.45 g/mol. Its IUPAC name is 2-fluoro-N-[2-[4-(furan-2-ylmethylsulfamoyl)anilino]-2-oxoethyl]benzamide.
| Compound Name | 2-fluoro-N-[2-[4-(furan-2-ylmethylsulfamoyl)anilino]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 2471000 |
| Molecular Formula | C20H18FN3O5S |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 2-fluoro-N-[2-[4-(furan-2-ylmethylsulfamoyl)anilino]-2-oxoethyl]benzamide |
| SMILES | O=C(CNC(=O)c1ccccc1F)Nc1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C20H18FN3O5S/c21-18-6-2-1-5-17(18)20(26)22-13-19(25)24-14-7-9-16(10-8-14)30(27,28)23-12-15-4-3-11-29-15/h1-11,23H,12-13H2,(H,22,26)(H,24,25) |
| InChIKey | KIBKWDYTZXEYJD-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 117.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |