C21H21FN2O4S — CID 31282083
N-[2-(2-fluorophenyl)ethyl]-5-(furan-2-ylmethylsulfamoyl)-2-methylbenzamide (PubChem CID 31282083) has the molecular formula C21H21FN2O4S and a molecular weight of 416.47 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-5-(furan-2-ylmethylsulfamoyl)-2-methylbenzamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-5-(furan-2-ylmethylsulfamoyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 31282083 |
| Molecular Formula | C21H21FN2O4S |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-5-(furan-2-ylmethylsulfamoyl)-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccco2)cc1C(=O)NCCc1ccccc1F |
| InChI | InChI=1S/C21H21FN2O4S/c1-15-8-9-18(29(26,27)24-14-17-6-4-12-28-17)13-19(15)21(25)23-11-10-16-5-2-3-7-20(16)22/h2-9,12-13,24H,10-11,14H2,1H3,(H,23,25) |
| InChIKey | ZEEWJZFTMSVUTL-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |