C20H19N3O7S — CID 46671837
5-(furan-2-ylmethylsulfamoyl)-N-[(2-hydroxy-5-nitrophenyl)methyl]-2-methylbenzamide (PubChem CID 46671837) has the molecular formula C20H19N3O7S and a molecular weight of 445.45 g/mol. Its IUPAC name is 5-(furan-2-ylmethylsulfamoyl)-N-[(2-hydroxy-5-nitrophenyl)methyl]-2-methylbenzamide.
| Compound Name | 5-(furan-2-ylmethylsulfamoyl)-N-[(2-hydroxy-5-nitrophenyl)methyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 46671837 |
| Molecular Formula | C20H19N3O7S |
| Molecular Weight | 445.45 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 5-(furan-2-ylmethylsulfamoyl)-N-[(2-hydroxy-5-nitrophenyl)methyl]-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccco2)cc1C(=O)NCc1cc([N+](=O)[O-])ccc1O |
| InChI | InChI=1S/C20H19N3O7S/c1-13-4-6-17(31(28,29)22-12-16-3-2-8-30-16)10-18(13)20(25)21-11-14-9-15(23(26)27)5-7-19(14)24/h2-10,22,24H,11-12H2,1H3,(H,21,25) |
| InChIKey | WGZWRYLMXOWKBR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 151.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.45 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|