C17H19N5O4S2 — CID 56544048
5-(furan-2-ylmethylsulfamoyl)-2-methyl-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]benzamide (PubChem CID 56544048) has the molecular formula C17H19N5O4S2 and a molecular weight of 421.50 g/mol. Its IUPAC name is 5-(furan-2-ylmethylsulfamoyl)-2-methyl-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]benzamide.
| Compound Name | 5-(furan-2-ylmethylsulfamoyl)-2-methyl-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 56544048 |
| Molecular Formula | C17H19N5O4S2 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 5-(furan-2-ylmethylsulfamoyl)-2-methyl-N-[(4-methyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)methyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccco2)cc1C(=O)NCc1n[nH]c(=S)n1C |
| InChI | InChI=1S/C17H19N5O4S2/c1-11-5-6-13(28(24,25)19-9-12-4-3-7-26-12)8-14(11)16(23)18-10-15-20-21-17(27)22(15)2/h3-8,19H,9-10H2,1-2H3,(H,18,23)(H,21,27) |
| InChIKey | DEZPAWADPUBHAW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 122.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|