C17H20N2O6S — CID 119237132
3-[[5-(furan-2-ylmethylsulfamoyl)-2-methylbenzoyl]amino]-2-methylpropanoic acid (PubChem CID 119237132) has the molecular formula C17H20N2O6S and a molecular weight of 380.42 g/mol. Its IUPAC name is 3-[[5-(furan-2-ylmethylsulfamoyl)-2-methylbenzoyl]amino]-2-methylpropanoic acid.
| Compound Name | 3-[[5-(furan-2-ylmethylsulfamoyl)-2-methylbenzoyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 119237132 |
| Molecular Formula | C17H20N2O6S |
| Molecular Weight | 380.42 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 3-[[5-(furan-2-ylmethylsulfamoyl)-2-methylbenzoyl]amino]-2-methylpropanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccco2)cc1C(=O)NCC(C)C(=O)O |
| InChI | InChI=1S/C17H20N2O6S/c1-11-5-6-14(26(23,24)19-10-13-4-3-7-25-13)8-15(11)16(20)18-9-12(2)17(21)22/h3-8,12,19H,9-10H2,1-2H3,(H,18,20)(H,21,22) |
| InChIKey | FBVIFOKTEHNAFM-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.42 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |