C19H24N2O6S — CID 75429428
3-[ethyl-[5-(furan-2-ylmethylsulfamoyl)-2-methylbenzoyl]amino]-2-methylpropanoic acid (PubChem CID 75429428) has the molecular formula C19H24N2O6S and a molecular weight of 408.48 g/mol. Its IUPAC name is 3-[ethyl-[5-(furan-2-ylmethylsulfamoyl)-2-methylbenzoyl]amino]-2-methylpropanoic acid.
| Compound Name | 3-[ethyl-[5-(furan-2-ylmethylsulfamoyl)-2-methylbenzoyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 75429428 |
| Molecular Formula | C19H24N2O6S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | 3-[ethyl-[5-(furan-2-ylmethylsulfamoyl)-2-methylbenzoyl]amino]-2-methylpropanoic acid |
| SMILES | CCN(CC(C)C(=O)O)C(=O)c1cc(S(=O)(=O)NCc2ccco2)ccc1C |
| InChI | InChI=1S/C19H24N2O6S/c1-4-21(12-14(3)19(23)24)18(22)17-10-16(8-7-13(17)2)28(25,26)20-11-15-6-5-9-27-15/h5-10,14,20H,4,11-12H2,1-3H3,(H,23,24) |
| InChIKey | WUMWDTLXIZWSRE-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |