C20H26N2O6S — CID 55349906
methyl 6-[[5-(furan-2-ylmethylsulfamoyl)-2-methylbenzoyl]amino]hexanoate (PubChem CID 55349906) has the molecular formula C20H26N2O6S and a molecular weight of 422.50 g/mol. Its IUPAC name is methyl 6-[[5-(furan-2-ylmethylsulfamoyl)-2-methylbenzoyl]amino]hexanoate.
| Compound Name | methyl 6-[[5-(furan-2-ylmethylsulfamoyl)-2-methylbenzoyl]amino]hexanoate |
|---|---|
| PubChem CID | 55349906 |
| Molecular Formula | C20H26N2O6S |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | methyl 6-[[5-(furan-2-ylmethylsulfamoyl)-2-methylbenzoyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)c1cc(S(=O)(=O)NCc2ccco2)ccc1C |
| InChI | InChI=1S/C20H26N2O6S/c1-15-9-10-17(29(25,26)22-14-16-7-6-12-28-16)13-18(15)20(24)21-11-5-3-4-8-19(23)27-2/h6-7,9-10,12-13,22H,3-5,8,11,14H2,1-2H3,(H,21,24) |
| InChIKey | YKFFGAJSUHKOOS-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|