C23H23N3O4S2 — CID 38901082
N-[3-(1,3-benzothiazol-2-yl)propyl]-5-(furan-2-ylmethylsulfamoyl)-2-methylbenzamide (PubChem CID 38901082) has the molecular formula C23H23N3O4S2 and a molecular weight of 469.59 g/mol. Its IUPAC name is N-[3-(1,3-benzothiazol-2-yl)propyl]-5-(furan-2-ylmethylsulfamoyl)-2-methylbenzamide.
| Compound Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-5-(furan-2-ylmethylsulfamoyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 38901082 |
| Molecular Formula | C23H23N3O4S2 |
| Molecular Weight | 469.59 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | N-[3-(1,3-benzothiazol-2-yl)propyl]-5-(furan-2-ylmethylsulfamoyl)-2-methylbenzamide |
| SMILES | Cc1ccc(S(=O)(=O)NCc2ccco2)cc1C(=O)NCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C23H23N3O4S2/c1-16-10-11-18(32(28,29)25-15-17-6-5-13-30-17)14-19(16)23(27)24-12-4-9-22-26-20-7-2-3-8-21(20)31-22/h2-3,5-8,10-11,13-14,25H,4,9,12,15H2,1H3,(H,24,27) |
| InChIKey | IXRQSDGATNSEKZ-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|