C18H23BrN2O4S — CID 30549771
2-bromo-5-(furan-2-ylmethylsulfamoyl)-N-hexylbenzamide (PubChem CID 30549771) has the molecular formula C18H23BrN2O4S and a molecular weight of 443.36 g/mol. Its IUPAC name is 2-bromo-5-(furan-2-ylmethylsulfamoyl)-N-hexylbenzamide.
| Compound Name | 2-bromo-5-(furan-2-ylmethylsulfamoyl)-N-hexylbenzamide |
|---|---|
| PubChem CID | 30549771 |
| Molecular Formula | C18H23BrN2O4S |
| Molecular Weight | 443.36 g/mol |
| Exact Mass | 442.06 |
| IUPAC Name | 2-bromo-5-(furan-2-ylmethylsulfamoyl)-N-hexylbenzamide |
| SMILES | CCCCCCNC(=O)c1cc(S(=O)(=O)NCc2ccco2)ccc1Br |
| InChI | InChI=1S/C18H23BrN2O4S/c1-2-3-4-5-10-20-18(22)16-12-15(8-9-17(16)19)26(23,24)21-13-14-7-6-11-25-14/h6-9,11-12,21H,2-5,10,13H2,1H3,(H,20,22) |
| InChIKey | CEXGOZSYBUTEAA-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.36 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|