C13H12BrNO5S — CID 51289514
methyl 2-bromo-5-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 51289514) has the molecular formula C13H12BrNO5S and a molecular weight of 374.21 g/mol. Its IUPAC name is methyl 2-bromo-5-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | methyl 2-bromo-5-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 51289514 |
| Molecular Formula | C13H12BrNO5S |
| Molecular Weight | 374.21 g/mol |
| Exact Mass | 372.96 |
| IUPAC Name | methyl 2-bromo-5-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | COC(=O)c1cc(S(=O)(=O)NCc2ccco2)ccc1Br |
| InChI | InChI=1S/C13H12BrNO5S/c1-19-13(16)11-7-10(4-5-12(11)14)21(17,18)15-8-9-3-2-6-20-9/h2-7,15H,8H2,1H3 |
| InChIKey | HRIZCOVZACNBCK-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.21 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |