C20H21N3O3S2 — CID 25039568
1-(3,5-dimethylphenyl)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]thiourea (PubChem CID 25039568) has the molecular formula C20H21N3O3S2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]thiourea.
| Compound Name | 1-(3,5-dimethylphenyl)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]thiourea |
|---|---|
| PubChem CID | 25039568 |
| Molecular Formula | C20H21N3O3S2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-3-[4-(furan-2-ylmethylsulfamoyl)phenyl]thiourea |
| SMILES | Cc1cc(C)cc(NC(=S)Nc2ccc(S(=O)(=O)NCc3ccco3)cc2)c1 |
| InChI | InChI=1S/C20H21N3O3S2/c1-14-10-15(2)12-17(11-14)23-20(27)22-16-5-7-19(8-6-16)28(24,25)21-13-18-4-3-9-26-18/h3-12,21H,13H2,1-2H3,(H2,22,23,27) |
| InChIKey | OIMJIDPNASRBRD-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|